C18H19ClN6 — CID 19134754
4-N-(2-chloro-3-pyridinyl)-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19134754) has the molecular formula C18H19ClN6 and a molecular weight of 354.85 g/mol. Its IUPAC name is 4-N-(2-chloro-3-pyridinyl)-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19134754 |
| Molecular Formula | C18H19ClN6 |
| Molecular Weight | 354.85 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(4-propan-2-ylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CC(C)c1ccc(Nc2ncnc(Nc3cccnc3Cl)c2N)cc1 |
| InChI | InChI=1S/C18H19ClN6/c1-11(2)12-5-7-13(8-6-12)24-17-15(20)18(23-10-22-17)25-14-4-3-9-21-16(14)19/h3-11H,20H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | UOZJXDHBZSHHOO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.85 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|