C18H17ClN6O2 — CID 19153439
ethyl 3-[[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19153439) has the molecular formula C18H17ClN6O2 and a molecular weight of 384.83 g/mol. Its IUPAC name is ethyl 3-[[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19153439 |
| Molecular Formula | C18H17ClN6O2 |
| Molecular Weight | 384.83 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | ethyl 3-[[5-amino-6-[(2-chloro-3-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(Nc3cccnc3Cl)c2N)c1 |
| InChI | InChI=1S/C18H17ClN6O2/c1-2-27-18(26)11-5-3-6-12(9-11)24-16-14(20)17(23-10-22-16)25-13-7-4-8-21-15(13)19/h3-10H,2,20H2,1H3,(H2,22,23,24,25) |
| InChIKey | KVRYXHNVRMCDSK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.83 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|