C23H28N6O4S — CID 19145358
ethyl 3-[[5-amino-6-[4-(diethylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19145358) has the molecular formula C23H28N6O4S and a molecular weight of 484.58 g/mol. Its IUPAC name is ethyl 3-[[5-amino-6-[4-(diethylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[5-amino-6-[4-(diethylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19145358 |
| Molecular Formula | C23H28N6O4S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | ethyl 3-[[5-amino-6-[4-(diethylsulfamoyl)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(Nc3ccc(S(=O)(=O)N(CC)CC)cc3)c2N)c1 |
| InChI | InChI=1S/C23H28N6O4S/c1-4-29(5-2)34(31,32)19-12-10-17(11-13-19)27-21-20(24)22(26-15-25-21)28-18-9-7-8-16(14-18)23(30)33-6-3/h7-15H,4-6,24H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | ASKZMSKNLONFDM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |