C20H20ClN5O2 — CID 19150572
ethyl 3-[[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19150572) has the molecular formula C20H20ClN5O2 and a molecular weight of 397.87 g/mol. Its IUPAC name is ethyl 3-[[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19150572 |
| Molecular Formula | C20H20ClN5O2 |
| Molecular Weight | 397.87 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | ethyl 3-[[5-amino-6-[(4-chlorophenyl)methylamino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(NCc3ccc(Cl)cc3)c2N)c1 |
| InChI | InChI=1S/C20H20ClN5O2/c1-2-28-20(27)14-4-3-5-16(10-14)26-19-17(22)18(24-12-25-19)23-11-13-6-8-15(21)9-7-13/h3-10,12H,2,11,22H2,1H3,(H2,23,24,25,26) |
| InChIKey | LIQUCALTMJGZBH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.87 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |