C19H15ClN4O4S — CID 23488606
ethyl 3-[[6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 23488606) has the molecular formula C19H15ClN4O4S and a molecular weight of 430.87 g/mol. Its IUPAC name is ethyl 3-[[6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 23488606 |
| Molecular Formula | C19H15ClN4O4S |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | ethyl 3-[[6-(4-chlorophenyl)sulfanyl-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(Sc3ccc(Cl)cc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H15ClN4O4S/c1-2-28-19(25)12-4-3-5-14(10-12)23-17-16(24(26)27)18(22-11-21-17)29-15-8-6-13(20)7-9-15/h3-11H,2H2,1H3,(H,21,22,23) |
| InChIKey | OENRJYULDUHCNS-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|