C18H15ClN4OS — CID 22547377
1-[3-[[5-amino-6-(4-chlorophenyl)sulfanylpyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 22547377) has the molecular formula C18H15ClN4OS and a molecular weight of 370.87 g/mol. Its IUPAC name is 1-[3-[[5-amino-6-(4-chlorophenyl)sulfanylpyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[5-amino-6-(4-chlorophenyl)sulfanylpyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 22547377 |
| Molecular Formula | C18H15ClN4OS |
| Molecular Weight | 370.87 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 1-[3-[[5-amino-6-(4-chlorophenyl)sulfanylpyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ncnc(Sc3ccc(Cl)cc3)c2N)c1 |
| InChI | InChI=1S/C18H15ClN4OS/c1-11(24)12-3-2-4-14(9-12)23-17-16(20)18(22-10-21-17)25-15-7-5-13(19)6-8-15/h2-10H,20H2,1H3,(H,21,22,23) |
| InChIKey | OVFHXZFCVZCTGI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.87 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |