C16H19N5O5 — CID 22534844
ethyl 3-[[6-(2-methoxyethylamino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22534844) has the molecular formula C16H19N5O5 and a molecular weight of 361.36 g/mol. Its IUPAC name is ethyl 3-[[6-(2-methoxyethylamino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[6-(2-methoxyethylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22534844 |
| Molecular Formula | C16H19N5O5 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | ethyl 3-[[6-(2-methoxyethylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(NCCOC)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N5O5/c1-3-26-16(22)11-5-4-6-12(9-11)20-15-13(21(23)24)14(18-10-19-15)17-7-8-25-2/h4-6,9-10H,3,7-8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | XCGIAMQHXOWYFL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 128.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|