C19H21N7O4 — CID 22538227
ethyl 3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22538227) has the molecular formula C19H21N7O4 and a molecular weight of 411.42 g/mol. Its IUPAC name is ethyl 3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22538227 |
| Molecular Formula | C19H21N7O4 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | ethyl 3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(Nc2ncnc(NCCCn3ccnc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H21N7O4/c1-2-30-19(27)14-5-3-6-15(11-14)24-18-16(26(28)29)17(22-12-23-18)21-7-4-9-25-10-8-20-13-25/h3,5-6,8,10-13H,2,4,7,9H2,1H3,(H2,21,22,23,24) |
| InChIKey | GSVFNLZYFMOEET-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|