C18H19N7O3 — CID 23486225
1-[3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone (PubChem CID 23486225) has the molecular formula C18H19N7O3 and a molecular weight of 381.40 g/mol. Its IUPAC name is 1-[3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone.
| Compound Name | 1-[3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
|---|---|
| PubChem CID | 23486225 |
| Molecular Formula | C18H19N7O3 |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 1-[3-[[6-(3-imidazol-1-ylpropylamino)-5-nitropyrimidin-4-yl]amino]phenyl]ethanone |
| SMILES | CC(=O)c1cccc(Nc2ncnc(NCCCn3ccnc3)c2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H19N7O3/c1-13(26)14-4-2-5-15(10-14)23-18-16(25(27)28)17(21-11-22-18)20-6-3-8-24-9-7-19-12-24/h2,4-5,7,9-12H,3,6,8H2,1H3,(H2,20,21,22,23) |
| InChIKey | FRPUTFBDKQXLCI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|