C16H15F2N7O2 — CID 22538644
4-N-(2,5-difluorophenyl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22538644) has the molecular formula C16H15F2N7O2 and a molecular weight of 375.34 g/mol. Its IUPAC name is 4-N-(2,5-difluorophenyl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2,5-difluorophenyl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22538644 |
| Molecular Formula | C16H15F2N7O2 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 4-N-(2,5-difluorophenyl)-6-N-(3-imidazol-1-ylpropyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCCn2ccnc2)ncnc1Nc1cc(F)ccc1F |
| InChI | InChI=1S/C16H15F2N7O2/c17-11-2-3-12(18)13(8-11)23-16-14(25(26)27)15(21-9-22-16)20-4-1-6-24-7-5-19-10-24/h2-3,5,7-10H,1,4,6H2,(H2,20,21,22,23) |
| InChIKey | BPTXTFRRWRWJHH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|