C13H8F2N6O2 — CID 22538661
N-(2,5-difluorophenyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine (PubChem CID 22538661) has the molecular formula C13H8F2N6O2 and a molecular weight of 318.24 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22538661 |
| Molecular Formula | C13H8F2N6O2 |
| Molecular Weight | 318.24 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-(2,5-difluorophenyl)-6-imidazol-1-yl-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cc(F)ccc2F)ncnc1-n1ccnc1 |
| InChI | InChI=1S/C13H8F2N6O2/c14-8-1-2-9(15)10(5-8)19-12-11(21(22)23)13(18-6-17-12)20-4-3-16-7-20/h1-7H,(H,17,18,19) |
| InChIKey | ZNTPEBAGNOCFFM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|