C15H12F2N6O2 — CID 22538664
N-(2,5-difluorophenyl)-6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 22538664) has the molecular formula C15H12F2N6O2 and a molecular weight of 346.30 g/mol. Its IUPAC name is N-(2,5-difluorophenyl)-6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(2,5-difluorophenyl)-6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22538664 |
| Molecular Formula | C15H12F2N6O2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | N-(2,5-difluorophenyl)-6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | Cc1cc(C)n(-c2ncnc(Nc3cc(F)ccc3F)c2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C15H12F2N6O2/c1-8-5-9(2)22(21-8)15-13(23(24)25)14(18-7-19-15)20-12-6-10(16)3-4-11(12)17/h3-7H,1-2H3,(H,18,19,20) |
| InChIKey | IVXCMXSQCQXASK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|