C19H23N7O4S — CID 22527926
4-[[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide (PubChem CID 22527926) has the molecular formula C19H23N7O4S and a molecular weight of 445.51 g/mol. Its IUPAC name is 4-[[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22527926 |
| Molecular Formula | C19H23N7O4S |
| Molecular Weight | 445.51 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[[6-(3,5-dimethylpyrazol-1-yl)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(-n3nc(C)cc3C)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H23N7O4S/c1-5-24(6-2)31(29,30)16-9-7-15(8-10-16)22-18-17(26(27)28)19(21-12-20-18)25-14(4)11-13(3)23-25/h7-12H,5-6H2,1-4H3,(H,20,21,22) |
| InChIKey | UMPBMUYUQPGGPJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|