C18H26N6O5S — CID 23493125
N,N-diethyl-4-[[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 23493125) has the molecular formula C18H26N6O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 23493125 |
| Molecular Formula | C18H26N6O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N,N-diethyl-4-[[6-[ethyl(2-hydroxyethyl)amino]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CCN(CCO)c1ncnc(Nc2ccc(S(=O)(=O)N(CC)CC)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N6O5S/c1-4-22(11-12-25)18-16(24(26)27)17(19-13-20-18)21-14-7-9-15(10-8-14)30(28,29)23(5-2)6-3/h7-10,13,25H,4-6,11-12H2,1-3H3,(H,19,20,21) |
| InChIKey | VFKSIPIFPCRDIL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 141.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|