C22H25N5O5S — CID 22527910
N,N-diethyl-4-[[6-(4-ethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 22527910) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-(4-ethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[6-(4-ethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 22527910 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N,N-diethyl-4-[[6-(4-ethylphenoxy)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CCc1ccc(Oc2ncnc(Nc3ccc(S(=O)(=O)N(CC)CC)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H25N5O5S/c1-4-16-7-11-18(12-8-16)32-22-20(27(28)29)21(23-15-24-22)25-17-9-13-19(14-10-17)33(30,31)26(5-2)6-3/h7-15H,4-6H2,1-3H3,(H,23,24,25) |
| InChIKey | KKUDUOXIRCIZEK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 127.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|