C17H19N7O4S — CID 22527923
N,N-diethyl-4-[(6-imidazol-1-yl-5-nitropyrimidin-4-yl)amino]benzenesulfonamide (PubChem CID 22527923) has the molecular formula C17H19N7O4S and a molecular weight of 417.45 g/mol. Its IUPAC name is N,N-diethyl-4-[(6-imidazol-1-yl-5-nitropyrimidin-4-yl)amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[(6-imidazol-1-yl-5-nitropyrimidin-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 22527923 |
| Molecular Formula | C17H19N7O4S |
| Molecular Weight | 417.45 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N,N-diethyl-4-[(6-imidazol-1-yl-5-nitropyrimidin-4-yl)amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(-n3ccnc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H19N7O4S/c1-3-23(4-2)29(27,28)14-7-5-13(6-8-14)21-16-15(24(25)26)17(20-11-19-16)22-10-9-18-12-22/h5-12H,3-4H2,1-2H3,(H,19,20,21) |
| InChIKey | LDDGXCWLEGULLM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|