C20H29N7O4S — CID 23490287
N,N-diethyl-4-[[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 23490287) has the molecular formula C20H29N7O4S and a molecular weight of 463.56 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 23490287 |
| Molecular Formula | C20H29N7O4S |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | N,N-diethyl-4-[[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CCN1CCN(c2ncnc(Nc3ccc(S(=O)(=O)N(CC)CC)cc3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H29N7O4S/c1-4-24-11-13-25(14-12-24)20-18(27(28)29)19(21-15-22-20)23-16-7-9-17(10-8-16)32(30,31)26(5-2)6-3/h7-10,15H,4-6,11-14H2,1-3H3,(H,21,22,23) |
| InChIKey | BNOIOSYVLOZVPX-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|