C12H21N7O2 — CID 23490289
2-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,1-dimethylhydrazine (PubChem CID 23490289) has the molecular formula C12H21N7O2 and a molecular weight of 295.35 g/mol. Its IUPAC name is 2-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,1-dimethylhydrazine.
| Compound Name | 2-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 23490289 |
| Molecular Formula | C12H21N7O2 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-yl]-1,1-dimethylhydrazine |
| SMILES | CCN1CCN(c2ncnc(NN(C)C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H21N7O2/c1-4-17-5-7-18(8-6-17)12-10(19(20)21)11(13-9-14-12)15-16(2)3/h9H,4-8H2,1-3H3,(H,13,14,15) |
| InChIKey | OFZJVYJNSBTFNK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|