C16H18Cl2N6O2 — CID 23483495
N-(3,5-dichlorophenyl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23483495) has the molecular formula C16H18Cl2N6O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(3,5-dichlorophenyl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23483495 |
| Molecular Formula | C16H18Cl2N6O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-(3,5-dichlorophenyl)-6-(4-ethylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CCN1CCN(c2ncnc(Nc3cc(Cl)cc(Cl)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H18Cl2N6O2/c1-2-22-3-5-23(6-4-22)16-14(24(25)26)15(19-10-20-16)21-13-8-11(17)7-12(18)9-13/h7-10H,2-6H2,1H3,(H,19,20,21) |
| InChIKey | WCCJHNDTCXMMTF-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|