C15H16Cl2N6O2 — CID 23483494
N-(3,5-dichlorophenyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23483494) has the molecular formula C15H16Cl2N6O2 and a molecular weight of 383.24 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(3,5-dichlorophenyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23483494 |
| Molecular Formula | C15H16Cl2N6O2 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-6-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CN1CCN(c2ncnc(Nc3cc(Cl)cc(Cl)c3)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C15H16Cl2N6O2/c1-21-2-4-22(5-3-21)15-13(23(24)25)14(18-9-19-15)20-12-7-10(16)6-11(17)8-12/h6-9H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | AGUCVKGUSANXTN-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|