C19H18ClN7O2 — CID 22532565
N-(3-chlorophenyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 22532565) has the molecular formula C19H18ClN7O2 and a molecular weight of 411.85 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(3-chlorophenyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 22532565 |
| Molecular Formula | C19H18ClN7O2 |
| Molecular Weight | 411.85 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | N-(3-chlorophenyl)-5-nitro-6-(4-pyridin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(Cl)c2)ncnc1N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C19H18ClN7O2/c20-14-4-3-5-15(12-14)24-18-17(27(28)29)19(23-13-22-18)26-10-8-25(9-11-26)16-6-1-2-7-21-16/h1-7,12-13H,8-11H2,(H,22,23,24) |
| InChIKey | GTJPQYZQESSSJD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 100.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.85 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|