C22H22ClN5O2 — CID 23491398
6-(4-benzylpiperidin-1-yl)-N-(3-chlorophenyl)-5-nitropyrimidin-4-amine (PubChem CID 23491398) has the molecular formula C22H22ClN5O2 and a molecular weight of 423.90 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-(3-chlorophenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-(3-chlorophenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491398 |
| Molecular Formula | C22H22ClN5O2 |
| Molecular Weight | 423.90 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-(3-chlorophenyl)-5-nitropyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc(Cl)c2)ncnc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H22ClN5O2/c23-18-7-4-8-19(14-18)26-21-20(28(29)30)22(25-15-24-21)27-11-9-17(10-12-27)13-16-5-2-1-3-6-16/h1-8,14-15,17H,9-13H2,(H,24,25,26) |
| InChIKey | JZEAFMLRXHISAT-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.90 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|