C24H26ClN5O4 — CID 23491468
6-(4-benzylpiperidin-1-yl)-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidin-4-amine (PubChem CID 23491468) has the molecular formula C24H26ClN5O4 and a molecular weight of 483.96 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23491468 |
| Molecular Formula | C24H26ClN5O4 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidin-4-amine |
| SMILES | COc1cc(OC)c(Nc2ncnc(N3CCC(Cc4ccccc4)CC3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C24H26ClN5O4/c1-33-20-14-21(34-2)19(13-18(20)25)28-23-22(30(31)32)24(27-15-26-23)29-10-8-17(9-11-29)12-16-6-4-3-5-7-16/h3-7,13-15,17H,8-12H2,1-2H3,(H,26,27,28) |
| InChIKey | QPKJWSFGFPGGHB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|