C19H24ClN5O4 — CID 23492531
N-(5-chloro-2,4-dimethoxyphenyl)-6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 23492531) has the molecular formula C19H24ClN5O4 and a molecular weight of 421.89 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23492531 |
| Molecular Formula | C19H24ClN5O4 |
| Molecular Weight | 421.89 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-6-(2-ethylpiperidin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1ncnc(Nc2cc(Cl)c(OC)cc2OC)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H24ClN5O4/c1-4-12-7-5-6-8-24(12)19-17(25(26)27)18(21-11-22-19)23-14-9-13(20)15(28-2)10-16(14)29-3/h9-12H,4-8H2,1-3H3,(H,21,22,23) |
| InChIKey | GTGYTMQUUAMKGU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.89 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|