C17H20ClN5O5 — CID 23481617
4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 23481617) has the molecular formula C17H20ClN5O5 and a molecular weight of 409.83 g/mol. Its IUPAC name is 4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23481617 |
| Molecular Formula | C17H20ClN5O5 |
| Molecular Weight | 409.83 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitro-6-N-(oxolan-2-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | COc1cc(OC)c(Nc2ncnc(NCC3CCCO3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H20ClN5O5/c1-26-13-7-14(27-2)12(6-11(13)18)22-17-15(23(24)25)16(20-9-21-17)19-8-10-4-3-5-28-10/h6-7,9-10H,3-5,8H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | YAJDAGUOAONIST-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.83 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|