C22H26ClN5O4 — CID 22525814
4-N-(1-adamantyl)-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22525814) has the molecular formula C22H26ClN5O4 and a molecular weight of 459.93 g/mol. Its IUPAC name is 4-N-(1-adamantyl)-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(1-adamantyl)-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22525814 |
| Molecular Formula | C22H26ClN5O4 |
| Molecular Weight | 459.93 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | 4-N-(1-adamantyl)-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1cc(OC)c(Nc2ncnc(NC34CC5CC(CC(C5)C3)C4)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C22H26ClN5O4/c1-31-17-7-18(32-2)16(6-15(17)23)26-20-19(28(29)30)21(25-11-24-20)27-22-8-12-3-13(9-22)5-14(4-12)10-22/h6-7,11-14H,3-5,8-10H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | DFTNLAWDNUFDEW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.93 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|