C26H24ClN5O4 — CID 23488409
4-N,4-N-dibenzyl-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23488409) has the molecular formula C26H24ClN5O4 and a molecular weight of 505.96 g/mol. Its IUPAC name is 4-N,4-N-dibenzyl-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-dibenzyl-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23488409 |
| Molecular Formula | C26H24ClN5O4 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 4-N,4-N-dibenzyl-6-N-(5-chloro-2,4-dimethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | COc1cc(OC)c(Nc2ncnc(N(Cc3ccccc3)Cc3ccccc3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C26H24ClN5O4/c1-35-22-14-23(36-2)21(13-20(22)27)30-25-24(32(33)34)26(29-17-28-25)31(15-18-9-5-3-6-10-18)16-19-11-7-4-8-12-19/h3-14,17H,15-16H2,1-2H3,(H,28,29,30) |
| InChIKey | XMNGLEDXOMMNOV-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|