C19H18ClN5O4 — CID 22527016
6-N-(5-chloro-2,4-dimethoxyphenyl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 22527016) has the molecular formula C19H18ClN5O4 and a molecular weight of 415.84 g/mol. Its IUPAC name is 6-N-(5-chloro-2,4-dimethoxyphenyl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(5-chloro-2,4-dimethoxyphenyl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22527016 |
| Molecular Formula | C19H18ClN5O4 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 6-N-(5-chloro-2,4-dimethoxyphenyl)-4-N-methyl-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | COc1cc(OC)c(Nc2ncnc(N(C)c3ccccc3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H18ClN5O4/c1-24(12-7-5-4-6-8-12)19-17(25(26)27)18(21-11-22-19)23-14-9-13(20)15(28-2)10-16(14)29-3/h4-11H,1-3H3,(H,21,22,23) |
| InChIKey | UGMCHFIAQXNZCS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|