C19H16ClN7O7 — CID 22535718
N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide (PubChem CID 22535718) has the molecular formula C19H16ClN7O7 and a molecular weight of 489.83 g/mol. Its IUPAC name is N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide.
| Compound Name | N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22535718 |
| Molecular Formula | C19H16ClN7O7 |
| Molecular Weight | 489.83 g/mol |
| Exact Mass | 489.08 |
| IUPAC Name | N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
| SMILES | COc1cc(OC)c(Nc2ncnc(NNC(=O)c3ccc([N+](=O)[O-])cc3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H16ClN7O7/c1-33-14-8-15(34-2)13(7-12(14)20)23-17-16(27(31)32)18(22-9-21-17)24-25-19(28)10-3-5-11(6-4-10)26(29)30/h3-9H,1-2H3,(H,25,28)(H2,21,22,23,24) |
| InChIKey | KKGXAKXKKDJGCN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 183.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.83 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|