C19H16BrClN6O5 — CID 22535472
4-bromo-N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22535472) has the molecular formula C19H16BrClN6O5 and a molecular weight of 523.73 g/mol. Its IUPAC name is 4-bromo-N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-bromo-N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22535472 |
| Molecular Formula | C19H16BrClN6O5 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 4-bromo-N'-[6-(5-chloro-2,4-dimethoxyanilino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COc1cc(OC)c(Nc2ncnc(NNC(=O)c3ccc(Br)cc3)c2[N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C19H16BrClN6O5/c1-31-14-8-15(32-2)13(7-12(14)21)24-17-16(27(29)30)18(23-9-22-17)25-26-19(28)10-3-5-11(20)6-4-10/h3-9H,1-2H3,(H,26,28)(H2,22,23,24,25) |
| InChIKey | PZDFIIHEHICFLA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 140.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|