C18H11BrClF3N6O3 — CID 23479723
4-bromo-N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 23479723) has the molecular formula C18H11BrClF3N6O3 and a molecular weight of 531.68 g/mol. Its IUPAC name is 4-bromo-N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-bromo-N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23479723 |
| Molecular Formula | C18H11BrClF3N6O3 |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 529.97 |
| IUPAC Name | 4-bromo-N'-[6-[2-chloro-5-(trifluoromethyl)anilino]-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2cc(C(F)(F)F)ccc2Cl)c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H11BrClF3N6O3/c19-11-4-1-9(2-5-11)17(30)28-27-16-14(29(31)32)15(24-8-25-16)26-13-7-10(18(21,22)23)3-6-12(13)20/h1-8H,(H,28,30)(H2,24,25,26,27) |
| InChIKey | GNZTVGNVSLHOCZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|