C17H12BrN7O5 — CID 22533079
N'-[6-(4-bromoanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide (PubChem CID 22533079) has the molecular formula C17H12BrN7O5 and a molecular weight of 474.23 g/mol. Its IUPAC name is N'-[6-(4-bromoanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide.
| Compound Name | N'-[6-(4-bromoanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22533079 |
| Molecular Formula | C17H12BrN7O5 |
| Molecular Weight | 474.23 g/mol |
| Exact Mass | 473.01 |
| IUPAC Name | N'-[6-(4-bromoanilino)-5-nitropyrimidin-4-yl]-4-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccc(Br)cc2)c1[N+](=O)[O-])c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H12BrN7O5/c18-11-3-5-12(6-4-11)21-15-14(25(29)30)16(20-9-19-15)22-23-17(26)10-1-7-13(8-2-10)24(27)28/h1-9H,(H,23,26)(H2,19,20,21,22) |
| InChIKey | AJIVBNONUJLSTE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 165.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.23 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|