C16H12BrN7O5 — CID 22535448
N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 22535448) has the molecular formula C16H12BrN7O5 and a molecular weight of 462.22 g/mol. Its IUPAC name is N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22535448 |
| Molecular Formula | C16H12BrN7O5 |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 461.01 |
| IUPAC Name | N'-[6-[2-(4-bromobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NNC(=O)c2ccco2)c1[N+](=O)[O-])c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H12BrN7O5/c17-10-5-3-9(4-6-10)15(25)22-20-13-12(24(27)28)14(19-8-18-13)21-23-16(26)11-2-1-7-29-11/h1-8H,(H,22,25)(H,23,26)(H2,18,19,20,21) |
| InChIKey | PELNEPIVDQPWNN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 164.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|