C15H12N8O6 — CID 22526845
N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 22526845) has the molecular formula C15H12N8O6 and a molecular weight of 400.31 g/mol. Its IUPAC name is N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22526845 |
| Molecular Formula | C15H12N8O6 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N'-[5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | O=C(NNc1ncnc(NNc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-])c1ccco1 |
| InChI | InChI=1S/C15H12N8O6/c24-15(11-2-1-7-29-11)21-20-14-12(23(27)28)13(16-8-17-14)19-18-9-3-5-10(6-4-9)22(25)26/h1-8,18H,(H,21,24)(H2,16,17,19,20) |
| InChIKey | SHOUXZVXNXTOMD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 190.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|