C16H12N6O6 — CID 22536812
4-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22536812) has the molecular formula C16H12N6O6 and a molecular weight of 384.31 g/mol. Its IUPAC name is 4-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22536812 |
| Molecular Formula | C16H12N6O6 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 4-[[6-[2-(furan-2-carbonyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncnc(NNC(=O)c3ccco3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H12N6O6/c23-15(11-2-1-7-28-11)21-20-14-12(22(26)27)13(17-8-18-14)19-10-5-3-9(4-6-10)16(24)25/h1-8H,(H,21,23)(H,24,25)(H2,17,18,19,20) |
| InChIKey | IGHQGZAXHKJCLV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 172.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|