C14H13N7O4S — CID 22533943
N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide (PubChem CID 22533943) has the molecular formula C14H13N7O4S and a molecular weight of 375.37 g/mol. Its IUPAC name is N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide.
| Compound Name | N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 22533943 |
| Molecular Formula | C14H13N7O4S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.07 |
| IUPAC Name | N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]furan-2-carbohydrazide |
| SMILES | Cc1nc(Nc2ncnc(NNC(=O)c3ccco3)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C14H13N7O4S/c1-7-8(2)26-14(17-7)18-11-10(21(23)24)12(16-6-15-11)19-20-13(22)9-4-3-5-25-9/h3-6H,1-2H3,(H,20,22)(H2,15,16,17,18,19) |
| InChIKey | GKFUIQACZHTEKQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 148.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|