C17H17N7O3S — CID 22533947
N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 22533947) has the molecular formula C17H17N7O3S and a molecular weight of 399.44 g/mol. Its IUPAC name is N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 22533947 |
| Molecular Formula | C17H17N7O3S |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | N'-[6-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | Cc1nc(Nc2ncnc(NNC(=O)Cc3ccccc3)c2[N+](=O)[O-])sc1C |
| InChI | InChI=1S/C17H17N7O3S/c1-10-11(2)28-17(20-10)21-15-14(24(26)27)16(19-9-18-15)23-22-13(25)8-12-6-4-3-5-7-12/h3-7,9H,8H2,1-2H3,(H,22,25)(H2,18,19,20,21,23) |
| InChIKey | IZZQWKWLCYNZFO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|