C17H22N6O3 — CID 22537046
N'-[6-(3-methylbutylamino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide (PubChem CID 22537046) has the molecular formula C17H22N6O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is N'-[6-(3-methylbutylamino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide.
| Compound Name | N'-[6-(3-methylbutylamino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
|---|---|
| PubChem CID | 22537046 |
| Molecular Formula | C17H22N6O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N'-[6-(3-methylbutylamino)-5-nitropyrimidin-4-yl]-2-phenylacetohydrazide |
| SMILES | CC(C)CCNc1ncnc(NNC(=O)Cc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H22N6O3/c1-12(2)8-9-18-16-15(23(25)26)17(20-11-19-16)22-21-14(24)10-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3,(H,21,24)(H2,18,19,20,22) |
| InChIKey | MRIZUXNOKQIZRC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|