C15H18N6O4 — CID 23487398
N'-[5-nitro-6-(propylamino)pyrimidin-4-yl]-2-phenoxyacetohydrazide (PubChem CID 23487398) has the molecular formula C15H18N6O4 and a molecular weight of 346.35 g/mol. Its IUPAC name is N'-[5-nitro-6-(propylamino)pyrimidin-4-yl]-2-phenoxyacetohydrazide.
| Compound Name | N'-[5-nitro-6-(propylamino)pyrimidin-4-yl]-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 23487398 |
| Molecular Formula | C15H18N6O4 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N'-[5-nitro-6-(propylamino)pyrimidin-4-yl]-2-phenoxyacetohydrazide |
| SMILES | CCCNc1ncnc(NNC(=O)COc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N6O4/c1-2-8-16-14-13(21(23)24)15(18-10-17-14)20-19-12(22)9-25-11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3,(H,19,22)(H2,16,17,18,20) |
| InChIKey | HKWNOOZOYFWKMW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|