C20H20N6O4 — CID 23482730
N'-[6-(2-ethylanilino)-5-nitropyrimidin-4-yl]-2-phenoxyacetohydrazide (PubChem CID 23482730) has the molecular formula C20H20N6O4 and a molecular weight of 408.42 g/mol. Its IUPAC name is N'-[6-(2-ethylanilino)-5-nitropyrimidin-4-yl]-2-phenoxyacetohydrazide.
| Compound Name | N'-[6-(2-ethylanilino)-5-nitropyrimidin-4-yl]-2-phenoxyacetohydrazide |
|---|---|
| PubChem CID | 23482730 |
| Molecular Formula | C20H20N6O4 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | N'-[6-(2-ethylanilino)-5-nitropyrimidin-4-yl]-2-phenoxyacetohydrazide |
| SMILES | CCc1ccccc1Nc1ncnc(NNC(=O)COc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N6O4/c1-2-14-8-6-7-11-16(14)23-19-18(26(28)29)20(22-13-21-19)25-24-17(27)12-30-15-9-4-3-5-10-15/h3-11,13H,2,12H2,1H3,(H,24,27)(H2,21,22,23,25) |
| InChIKey | JMSVJTMZZKOPCJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|