C15H20N6O2 — CID 23481384
6-N-(3-methylbutyl)-5-nitro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine (PubChem CID 23481384) has the molecular formula C15H20N6O2 and a molecular weight of 316.37 g/mol. Its IUPAC name is 6-N-(3-methylbutyl)-5-nitro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine.
| Compound Name | 6-N-(3-methylbutyl)-5-nitro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23481384 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 6-N-(3-methylbutyl)-5-nitro-4-N-(pyridin-3-ylmethyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)CCNc1ncnc(NCc2cccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H20N6O2/c1-11(2)5-7-17-14-13(21(22)23)15(20-10-19-14)18-9-12-4-3-6-16-8-12/h3-4,6,8,10-11H,5,7,9H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | SFPCWHYMFRKSDK-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 105.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|