C10H11N7O2 — CID 23481340
6-hydrazinyl-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 23481340) has the molecular formula C10H11N7O2 and a molecular weight of 261.25 g/mol. Its IUPAC name is 6-hydrazinyl-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23481340 |
| Molecular Formula | C10H11N7O2 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 6-hydrazinyl-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | NNc1ncnc(NCc2cccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N7O2/c11-16-10-8(17(18)19)9(14-6-15-10)13-5-7-2-1-3-12-4-7/h1-4,6H,5,11H2,(H2,13,14,15,16) |
| InChIKey | UBIPGTMQMAYOEP-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 131.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|