C10H13N7 — CID 22542824
6-hydrazinyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 22542824) has the molecular formula C10H13N7 and a molecular weight of 231.26 g/mol. Its IUPAC name is 6-hydrazinyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 6-hydrazinyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22542824 |
| Molecular Formula | C10H13N7 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 6-hydrazinyl-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | NNc1ncnc(NCc2cccnc2)c1N |
| InChI | InChI=1S/C10H13N7/c11-8-9(15-6-16-10(8)17-12)14-5-7-2-1-3-13-4-7/h1-4,6H,5,11-12H2,(H2,14,15,16,17) |
| InChIKey | UKCGZWOHXCGHPW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|