C13H18N6O — CID 22542825
6-N-(2-methoxyethyl)-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5,6-triamine (PubChem CID 22542825) has the molecular formula C13H18N6O and a molecular weight of 274.33 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(2-methoxyethyl)-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22542825 |
| Molecular Formula | C13H18N6O |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6-N-(2-methoxyethyl)-4-N-(pyridin-3-ylmethyl)pyrimidine-4,5,6-triamine |
| SMILES | COCCNc1ncnc(NCc2cccnc2)c1N |
| InChI | InChI=1S/C13H18N6O/c1-20-6-5-16-12-11(14)13(19-9-18-12)17-8-10-3-2-4-15-7-10/h2-4,7,9H,5-6,8,14H2,1H3,(H2,16,17,18,19) |
| InChIKey | WRFHEVOQYNDKMY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|