C18H17N5O3 — CID 22542700
methyl 4-[5-amino-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]oxybenzoate (PubChem CID 22542700) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is methyl 4-[5-amino-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[5-amino-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 22542700 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | methyl 4-[5-amino-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(NCc3cccnc3)c2N)cc1 |
| InChI | InChI=1S/C18H17N5O3/c1-25-18(24)13-4-6-14(7-5-13)26-17-15(19)16(22-11-23-17)21-10-12-3-2-8-20-9-12/h2-9,11H,10,19H2,1H3,(H,21,22,23) |
| InChIKey | JAEUTQVAQBPBEM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |