C19H18N4O4 — CID 22544764
methyl 4-[5-amino-6-(2-methoxyanilino)pyrimidin-4-yl]oxybenzoate (PubChem CID 22544764) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is methyl 4-[5-amino-6-(2-methoxyanilino)pyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[5-amino-6-(2-methoxyanilino)pyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 22544764 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | methyl 4-[5-amino-6-(2-methoxyanilino)pyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(Nc3ccccc3OC)c2N)cc1 |
| InChI | InChI=1S/C19H18N4O4/c1-25-15-6-4-3-5-14(15)23-17-16(20)18(22-11-21-17)27-13-9-7-12(8-10-13)19(24)26-2/h3-11H,20H2,1-2H3,(H,21,22,23) |
| InChIKey | ZJNWWPSZHSKWMA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |