C20H19N3O4 — CID 22544861
methyl 4-[5-amino-6-(3,4-dimethylphenoxy)pyrimidin-4-yl]oxybenzoate (PubChem CID 22544861) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is methyl 4-[5-amino-6-(3,4-dimethylphenoxy)pyrimidin-4-yl]oxybenzoate.
| Compound Name | methyl 4-[5-amino-6-(3,4-dimethylphenoxy)pyrimidin-4-yl]oxybenzoate |
|---|---|
| PubChem CID | 22544861 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl 4-[5-amino-6-(3,4-dimethylphenoxy)pyrimidin-4-yl]oxybenzoate |
| SMILES | COC(=O)c1ccc(Oc2ncnc(Oc3ccc(C)c(C)c3)c2N)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-12-4-7-16(10-13(12)2)27-19-17(21)18(22-11-23-19)26-15-8-5-14(6-9-15)20(24)25-3/h4-11H,21H2,1-3H3 |
| InChIKey | VWKMVUCQLPUTOX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |