C18H16N8O5 — CID 23481366
2-(4-nitrophenyl)-N'-[5-nitro-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]acetohydrazide (PubChem CID 23481366) has the molecular formula C18H16N8O5 and a molecular weight of 424.38 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N'-[5-nitro-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]acetohydrazide.
| Compound Name | 2-(4-nitrophenyl)-N'-[5-nitro-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 23481366 |
| Molecular Formula | C18H16N8O5 |
| Molecular Weight | 424.38 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 2-(4-nitrophenyl)-N'-[5-nitro-6-(pyridin-3-ylmethylamino)pyrimidin-4-yl]acetohydrazide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NNc1ncnc(NCc2cccnc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H16N8O5/c27-15(8-12-3-5-14(6-4-12)25(28)29)23-24-18-16(26(30)31)17(21-11-22-18)20-10-13-2-1-7-19-9-13/h1-7,9,11H,8,10H2,(H,23,27)(H2,20,21,22,24) |
| InChIKey | VWNLZHVFGKVCRT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 178.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|