C12H11N7O5 — CID 23489086
N'-(6-amino-5-nitropyrimidin-4-yl)-2-(4-nitrophenyl)acetohydrazide (PubChem CID 23489086) has the molecular formula C12H11N7O5 and a molecular weight of 333.26 g/mol. Its IUPAC name is N'-(6-amino-5-nitropyrimidin-4-yl)-2-(4-nitrophenyl)acetohydrazide.
| Compound Name | N'-(6-amino-5-nitropyrimidin-4-yl)-2-(4-nitrophenyl)acetohydrazide |
|---|---|
| PubChem CID | 23489086 |
| Molecular Formula | C12H11N7O5 |
| Molecular Weight | 333.26 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N'-(6-amino-5-nitropyrimidin-4-yl)-2-(4-nitrophenyl)acetohydrazide |
| SMILES | Nc1ncnc(NNC(=O)Cc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H11N7O5/c13-11-10(19(23)24)12(15-6-14-11)17-16-9(20)5-7-1-3-8(4-2-7)18(21)22/h1-4,6H,5H2,(H,16,20)(H3,13,14,15,17) |
| InChIKey | BIXSQKMNZJPFDU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 179.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|