C13H12N8O6 — CID 4557205
N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-nitrobenzamide (PubChem CID 4557205) has the molecular formula C13H12N8O6 and a molecular weight of 376.29 g/mol. Its IUPAC name is N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-nitrobenzamide.
| Compound Name | N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4557205 |
| Molecular Formula | C13H12N8O6 |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | N-[2-[2-(6-amino-5-nitropyrimidin-4-yl)hydrazinyl]-2-oxoethyl]-4-nitrobenzamide |
| SMILES | Nc1ncnc(NNC(=O)CNC(=O)c2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12N8O6/c14-11-10(21(26)27)12(17-6-16-11)19-18-9(22)5-15-13(23)7-1-3-8(4-2-7)20(24)25/h1-4,6H,5H2,(H,15,23)(H,18,22)(H3,14,16,17,19) |
| InChIKey | IHERWZFOSUIKLG-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 208.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|